C6H15N3O — CID 123312987
1,2-diamino-4-(methylamino)pentan-3-one (PubChem CID 123312987) has the molecular formula C6H15N3O and a molecular weight of 145.21 g/mol. Its IUPAC name is 1,2-diamino-4-(methylamino)pentan-3-one.
| Compound Name | 1,2-diamino-4-(methylamino)pentan-3-one |
|---|---|
| PubChem CID | 123312987 |
| Molecular Formula | C6H15N3O |
| Molecular Weight | 145.21 g/mol |
| Exact Mass | 145.12 |
| IUPAC Name | 1,2-diamino-4-(methylamino)pentan-3-one |
| SMILES | CNC(C)C(=O)C(N)CN |
| InChI | InChI=1S/C6H15N3O/c1-4(9-2)6(10)5(8)3-7/h4-5,9H,3,7-8H2,1-2H3 |
| InChIKey | RXAIXURLYQNMAV-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.21 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |