C26H29BN4O5S — CID 123315269
[1-[[(Z)-2-benzyl-3-[[4-(pyridin-3-ylamino)phenyl]sulfonylamino]prop-2-enoyl]amino]-2-cyclopropylethyl]boronic acid (PubChem CID 123315269) has the molecular formula C26H29BN4O5S and a molecular weight of 520.42 g/mol. Its IUPAC name is [1-[[(Z)-2-benzyl-3-[[4-(pyridin-3-ylamino)phenyl]sulfonylamino]prop-2-enoyl]amino]-2-cyclopropylethyl]boronic acid.
| Compound Name | [1-[[(Z)-2-benzyl-3-[[4-(pyridin-3-ylamino)phenyl]sulfonylamino]prop-2-enoyl]amino]-2-cyclopropylethyl]boronic acid |
|---|---|
| PubChem CID | 123315269 |
| Molecular Formula | C26H29BN4O5S |
| Molecular Weight | 520.42 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | [1-[[(Z)-2-benzyl-3-[[4-(pyridin-3-ylamino)phenyl]sulfonylamino]prop-2-enoyl]amino]-2-cyclopropylethyl]boronic acid |
| SMILES | O=C(NC(CC1CC1)B(O)O)/C(=C\NS(=O)(=O)c1ccc(Nc2cccnc2)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C26H29BN4O5S/c32-26(31-25(27(33)34)16-20-8-9-20)21(15-19-5-2-1-3-6-19)17-29-37(35,36)24-12-10-22(11-13-24)30-23-7-4-14-28-18-23/h1-7,10-14,17-18,20,25,29-30,33-34H,8-9,15-16H2,(H,31,32)/b21-17- |
| InChIKey | NGONNCZIZZCVCQ-FXBPSFAMSA-N |
| XLogP | 2.53 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|