C11H17N — CID 123318822
2-methyl-N-[(3Z)-penta-1,3-dien-2-yl]pent-2-en-1-imine (PubChem CID 123318822) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is 2-methyl-N-[(3Z)-penta-1,3-dien-2-yl]pent-2-en-1-imine.
| Compound Name | 2-methyl-N-[(3Z)-penta-1,3-dien-2-yl]pent-2-en-1-imine |
|---|---|
| PubChem CID | 123318822 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 2-methyl-N-[(3Z)-penta-1,3-dien-2-yl]pent-2-en-1-imine |
| SMILES | C=C(/C=C\C)/N=C/C(C)=CCC |
| InChI | InChI=1S/C11H17N/c1-5-7-10(3)9-12-11(4)8-6-2/h6-9H,4-5H2,1-3H3/b8-6-,10-7?,12-9+ |
| InChIKey | UECNMHRHCFXODQ-IFZABKBUSA-N |
| XLogP | 3.50 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|