C4H7F2N — CID 123319591
1,1-difluoro-N-methylpropan-2-imine (PubChem CID 123319591) has the molecular formula C4H7F2N and a molecular weight of 107.10 g/mol. Its IUPAC name is 1,1-difluoro-N-methylpropan-2-imine.
| Compound Name | 1,1-difluoro-N-methylpropan-2-imine |
|---|---|
| PubChem CID | 123319591 |
| Molecular Formula | C4H7F2N |
| Molecular Weight | 107.10 g/mol |
| Exact Mass | 107.05 |
| IUPAC Name | 1,1-difluoro-N-methylpropan-2-imine |
| SMILES | C/N=C(\C)C(F)F |
| InChI | InChI=1S/C4H7F2N/c1-3(7-2)4(5)6/h4H,1-2H3/b7-3+ |
| InChIKey | XAWBDWXMTMFNHV-XVNBXDOJSA-N |
| XLogP | 1.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 107.10 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|