C31H28F4N6O4S2 — CID 123320809
1-[[2-[(2,6-difluorophenyl)methylamino]-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-3-[(3,5-difluorophenyl)sulfonylmethyl]cyclopentane-1,2-diol (PubChem CID 123320809) has the molecular formula C31H28F4N6O4S2 and a molecular weight of 688.73 g/mol. Its IUPAC name is 1-[[2-[(2,6-difluorophenyl)methylamino]-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-3-[(3,5-difluorophenyl)sulfonylmethyl]cyclopentane-1,2-diol.
| Compound Name | 1-[[2-[(2,6-difluorophenyl)methylamino]-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-3-[(3,5-difluorophenyl)sulfonylmethyl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 123320809 |
| Molecular Formula | C31H28F4N6O4S2 |
| Molecular Weight | 688.73 g/mol |
| Exact Mass | 688.15 |
| IUPAC Name | 1-[[2-[(2,6-difluorophenyl)methylamino]-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-3-[(3,5-difluorophenyl)sulfonylmethyl]cyclopentane-1,2-diol |
| SMILES | Cc1nc(NCc2c(F)cccc2F)nc(NC2(O)CCC(CS(=O)(=O)c3cc(F)cc(F)c3)C2O)c1-c1nc2c(C)nccc2s1 |
| InChI | InChI=1S/C31H28F4N6O4S2/c1-15-25(29-39-26-16(2)36-9-7-24(26)46-29)28(40-30(38-15)37-13-21-22(34)4-3-5-23(21)35)41-31(43)8-6-17(27(31)42)14-47(44,45)20-11-18(32)10-19(33)12-20/h3-5,7,9-12,17,27,42-43H,6,8,13-14H2,1-2H3,(H2,37,38,40,41) |
| InChIKey | CUMUPKOGTDBJIG-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 150.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.73 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|