C26H29F2N7O3S — CID 123735288
1-[[5-(4-amino-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-[(2,6-difluorophenyl)methylamino]-6-methylpyrimidin-4-yl]amino]-3-(2-hydroxypropan-2-yl)cyclopentane-1,2-diol (PubChem CID 123735288) has the molecular formula C26H29F2N7O3S and a molecular weight of 557.63 g/mol. Its IUPAC name is 1-[[5-(4-amino-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-[(2,6-difluorophenyl)methylamino]-6-methylpyrimidin-4-yl]amino]-3-(2-hydroxypropan-2-yl)cyclopentane-1,2-diol.
| Compound Name | 1-[[5-(4-amino-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-[(2,6-difluorophenyl)methylamino]-6-methylpyrimidin-4-yl]amino]-3-(2-hydroxypropan-2-yl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 123735288 |
| Molecular Formula | C26H29F2N7O3S |
| Molecular Weight | 557.63 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | 1-[[5-(4-amino-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-[(2,6-difluorophenyl)methylamino]-6-methylpyrimidin-4-yl]amino]-3-(2-hydroxypropan-2-yl)cyclopentane-1,2-diol |
| SMILES | Cc1nc(NCc2c(F)cccc2F)nc(NC2(O)CCC(C(C)(C)O)C2O)c1-c1nc2c(N)nccc2s1 |
| InChI | InChI=1S/C26H29F2N7O3S/c1-12-18(23-33-19-17(39-23)8-10-30-21(19)29)22(35-26(38)9-7-14(20(26)36)25(2,3)37)34-24(32-12)31-11-13-15(27)5-4-6-16(13)28/h4-6,8,10,14,20,36-38H,7,9,11H2,1-3H3,(H2,29,30)(H2,31,32,34,35) |
| InChIKey | ZHFQCFRNTWORSW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 162.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.63 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|