C32H40NO4+ — CID 123321533
5-(cyclopropylmethyl)-11,15-dimethoxy-5-methyl-16-(phenoxymethyl)-13-oxa-5-azoniahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-triene (PubChem CID 123321533) has the molecular formula C32H40NO4+ and a molecular weight of 502.68 g/mol. Its IUPAC name is 5-(cyclopropylmethyl)-11,15-dimethoxy-5-methyl-16-(phenoxymethyl)-13-oxa-5-azoniahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-triene.
| Compound Name | 5-(cyclopropylmethyl)-11,15-dimethoxy-5-methyl-16-(phenoxymethyl)-13-oxa-5-azoniahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-triene |
|---|---|
| PubChem CID | 123321533 |
| Molecular Formula | C32H40NO4+ |
| Molecular Weight | 502.68 g/mol |
| Exact Mass | 502.30 |
| IUPAC Name | 5-(cyclopropylmethyl)-11,15-dimethoxy-5-methyl-16-(phenoxymethyl)-13-oxa-5-azoniahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-triene |
| SMILES | COc1ccc2c3c1OC1C4(OC)CCC5(CC4COc4ccccc4)C(C2)[N+](C)(CC2CC2)CCC315 |
| InChI | InChI=1S/C32H40NO4/c1-33(19-21-9-10-21)16-15-31-27-22-11-12-25(34-2)28(27)37-29(31)32(35-3)14-13-30(31,26(33)17-22)18-23(32)20-36-24-7-5-4-6-8-24/h4-8,11-12,21,23,26,29H,9-10,13-20H2,1-3H3/q+1 |
| InChIKey | HLOOTFAQODXAHN-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.68 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|