C33H42NO4+ — CID 71585323
(1S,2S,6R,14R,15R,16R)-5-(cyclopropylmethyl)-15-methoxy-5-methyl-16-[(4-methylphenyl)methoxymethyl]-13-oxa-5-azoniahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-ol (PubChem CID 71585323) has the molecular formula C33H42NO4+ and a molecular weight of 516.70 g/mol. Its IUPAC name is (1S,2S,6R,14R,15R,16R)-5-(cyclopropylmethyl)-15-methoxy-5-methyl-16-[(4-methylphenyl)methoxymethyl]-13-oxa-5-azoniahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-ol.
| Compound Name | (1S,2S,6R,14R,15R,16R)-5-(cyclopropylmethyl)-15-methoxy-5-methyl-16-[(4-methylphenyl)methoxymethyl]-13-oxa-5-azoniahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-ol |
|---|---|
| PubChem CID | 71585323 |
| Molecular Formula | C33H42NO4+ |
| Molecular Weight | 516.70 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | (1S,2S,6R,14R,15R,16R)-5-(cyclopropylmethyl)-15-methoxy-5-methyl-16-[(4-methylphenyl)methoxymethyl]-13-oxa-5-azoniahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-ol |
| SMILES | CO[C@]12CC[C@@]3(C[C@@H]1COCc1ccc(C)cc1)[C@H]1Cc4ccc(O)c5c4[C@@]3(CC[N+]1(C)CC1CC1)[C@H]2O5 |
| InChI | InChI=1S/C33H41NO4/c1-21-4-6-23(7-5-21)19-37-20-25-17-31-12-13-33(25,36-3)30-32(31)14-15-34(2,18-22-8-9-22)27(31)16-24-10-11-26(35)29(38-30)28(24)32/h4-7,10-11,22,25,27,30H,8-9,12-20H2,1-3H3/p+1/t25-,27-,30-,31-,32+,33-,34?/m1/s1 |
| InChIKey | IGOLICYRRBXJAC-QAKVHLFHSA-O |
| XLogP | 5.29 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.70 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|