C30H43NO4 — CID 50917089
(2S,5R,6R,14S,15S,16S)-5-(cyclopropylmethyl)-16-(2-hydroxy-3,3-dimethylbutan-2-yl)-15-methoxy-5-methyl-13-oxa-5-azoniahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-olate (PubChem CID 50917089) has the molecular formula C30H43NO4 and a molecular weight of 481.68 g/mol. Its IUPAC name is (2S,5R,6R,14S,15S,16S)-5-(cyclopropylmethyl)-16-(2-hydroxy-3,3-dimethylbutan-2-yl)-15-methoxy-5-methyl-13-oxa-5-azoniahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-olate.
| Compound Name | (2S,5R,6R,14S,15S,16S)-5-(cyclopropylmethyl)-16-(2-hydroxy-3,3-dimethylbutan-2-yl)-15-methoxy-5-methyl-13-oxa-5-azoniahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-olate |
|---|---|
| PubChem CID | 50917089 |
| Molecular Formula | C30H43NO4 |
| Molecular Weight | 481.68 g/mol |
| Exact Mass | 481.32 |
| IUPAC Name | (2S,5R,6R,14S,15S,16S)-5-(cyclopropylmethyl)-16-(2-hydroxy-3,3-dimethylbutan-2-yl)-15-methoxy-5-methyl-13-oxa-5-azoniahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-olate |
| SMILES | CO[C@@]12CCC3(C[C@H]1C(C)(O)C(C)(C)C)[C@H]1Cc4ccc([O-])c5c4[C@@]3(CC[N@+]1(C)CC1CC1)[C@@H]2O5 |
| InChI | InChI=1S/C30H43NO4/c1-26(2,3)27(4,33)21-16-28-11-12-30(21,34-6)25-29(28)13-14-31(5,17-18-7-8-18)22(28)15-19-9-10-20(32)24(35-25)23(19)29/h9-10,18,21-22,25,33H,7-8,11-17H2,1-6H3/t21-,22+,25-,27?,28?,29-,30-,31+/m0/s1 |
| InChIKey | PBJOFIHCQTTZBR-VQNIFRQSSA-N |
| XLogP | 3.93 |
| TPSA | 61.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.68 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|