C13H22 — CID 123326067
4-(2-methylpropyl)nona-1,2,4-triene (PubChem CID 123326067) has the molecular formula C13H22 and a molecular weight of 178.32 g/mol. Its IUPAC name is 4-(2-methylpropyl)nona-1,2,4-triene.
| Compound Name | 4-(2-methylpropyl)nona-1,2,4-triene |
|---|---|
| PubChem CID | 123326067 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | 4-(2-methylpropyl)nona-1,2,4-triene |
| SMILES | C=C=CC(=CCCCC)CC(C)C |
| InChI | InChI=1S/C13H22/c1-5-7-8-10-13(9-6-2)11-12(3)4/h9-10,12H,2,5,7-8,11H2,1,3-4H3 |
| InChIKey | GRAYSTQFUCYWAL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|