C12H10N2O2 — CID 123327955
6-methoxy-9-methyl-[1]benzofuro[3,2-d]pyrimidine (PubChem CID 123327955) has the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. Its IUPAC name is 6-methoxy-9-methyl-[1]benzofuro[3,2-d]pyrimidine.
| Compound Name | 6-methoxy-9-methyl-[1]benzofuro[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 123327955 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 6-methoxy-9-methyl-[1]benzofuro[3,2-d]pyrimidine |
| SMILES | COc1ccc(C)c2c1oc1cncnc12 |
| InChI | InChI=1S/C12H10N2O2/c1-7-3-4-8(15-2)12-10(7)11-9(16-12)5-13-6-14-11/h3-6H,1-2H3 |
| InChIKey | CKGUIFWJOKNKNN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |