C10H11N3O2 — CID 605485
5,8-dimethoxyquinazolin-6-amine (PubChem CID 605485) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is 5,8-dimethoxyquinazolin-6-amine.
| Compound Name | 5,8-dimethoxyquinazolin-6-amine |
|---|---|
| PubChem CID | 605485 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 5,8-dimethoxyquinazolin-6-amine |
| SMILES | COc1c(N)cc(OC)c2ncncc12 |
| InChI | InChI=1S/C10H11N3O2/c1-14-8-3-7(11)10(15-2)6-4-12-5-13-9(6)8/h3-5H,11H2,1-2H3 |
| InChIKey | ZSCPUJKJXKOSSZ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|