C18H20N4O2 — CID 123330452
(1E)-2-(5-tert-butyl-1,2-oxazol-3-yl)-N-(2,5-dimethylanilino)-2-oxoethanimidoyl isocyanide (PubChem CID 123330452) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is (1E)-2-(5-tert-butyl-1,2-oxazol-3-yl)-N-(2,5-dimethylanilino)-2-oxoethanimidoyl isocyanide.
| Compound Name | (1E)-2-(5-tert-butyl-1,2-oxazol-3-yl)-N-(2,5-dimethylanilino)-2-oxoethanimidoyl isocyanide |
|---|---|
| PubChem CID | 123330452 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | (1E)-2-(5-tert-butyl-1,2-oxazol-3-yl)-N-(2,5-dimethylanilino)-2-oxoethanimidoyl isocyanide |
| SMILES | [C-]#[N+]/C(=N/Nc1cc(C)ccc1C)C(=O)c1cc(C(C)(C)C)on1 |
| InChI | InChI=1S/C18H20N4O2/c1-11-7-8-12(2)13(9-11)20-21-17(19-6)16(23)14-10-15(24-22-14)18(3,4)5/h7-10,20H,1-5H3/b21-17+ |
| InChIKey | ZYSXNOOWLFFNQA-HEHNFIMWSA-N |
| XLogP | 4.12 |
| TPSA | 71.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|