C16H14Cl2N4O2 — CID 78155274
2-(5-tert-butyl-1,2-oxazol-3-yl)-N-(2,3-dichloroanilino)-2-oxoethanimidoyl cyanide (PubChem CID 78155274) has the molecular formula C16H14Cl2N4O2 and a molecular weight of 365.22 g/mol. Its IUPAC name is 2-(5-tert-butyl-1,2-oxazol-3-yl)-N-(2,3-dichloroanilino)-2-oxoethanimidoyl cyanide.
| Compound Name | 2-(5-tert-butyl-1,2-oxazol-3-yl)-N-(2,3-dichloroanilino)-2-oxoethanimidoyl cyanide |
|---|---|
| PubChem CID | 78155274 |
| Molecular Formula | C16H14Cl2N4O2 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 2-(5-tert-butyl-1,2-oxazol-3-yl)-N-(2,3-dichloroanilino)-2-oxoethanimidoyl cyanide |
| SMILES | CC(C)(C)c1cc(C(=O)C(C#N)=NNc2cccc(Cl)c2Cl)no1 |
| InChI | InChI=1S/C16H14Cl2N4O2/c1-16(2,3)13-7-11(22-24-13)15(23)12(8-19)21-20-10-6-4-5-9(17)14(10)18/h4-7,20H,1-3H3 |
| InChIKey | FBSNXVYNQVEBEI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 91.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|