C12H13ClN4O — CID 14012285
(1E)-2-amino-N-(3-chloro-2-propylanilino)-2-oxoethanimidoyl cyanide (PubChem CID 14012285) has the molecular formula C12H13ClN4O and a molecular weight of 264.72 g/mol. Its IUPAC name is (1E)-2-amino-N-(3-chloro-2-propylanilino)-2-oxoethanimidoyl cyanide.
| Compound Name | (1E)-2-amino-N-(3-chloro-2-propylanilino)-2-oxoethanimidoyl cyanide |
|---|---|
| PubChem CID | 14012285 |
| Molecular Formula | C12H13ClN4O |
| Molecular Weight | 264.72 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | (1E)-2-amino-N-(3-chloro-2-propylanilino)-2-oxoethanimidoyl cyanide |
| SMILES | CCCc1c(Cl)cccc1N/N=C(\C#N)C(N)=O |
| InChI | InChI=1S/C12H13ClN4O/c1-2-4-8-9(13)5-3-6-10(8)16-17-11(7-14)12(15)18/h3,5-6,16H,2,4H2,1H3,(H2,15,18)/b17-11+ |
| InChIKey | KOLLXMYNJMQXSR-GZTJUZNOSA-N |
| XLogP | 2.07 |
| TPSA | 91.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.72 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|