C19H14F4N4O — CID 123331801
(4R)-1,1,5',5'-tetrafluoro-6-(5-isocyano-3-pyridinyl)spiro[2,3-dihydronaphthalene-4,4'-6H-1,3-oxazine]-2'-amine (PubChem CID 123331801) has the molecular formula C19H14F4N4O and a molecular weight of 390.34 g/mol. Its IUPAC name is (4R)-1,1,5',5'-tetrafluoro-6-(5-isocyano-3-pyridinyl)spiro[2,3-dihydronaphthalene-4,4'-6H-1,3-oxazine]-2'-amine.
| Compound Name | (4R)-1,1,5',5'-tetrafluoro-6-(5-isocyano-3-pyridinyl)spiro[2,3-dihydronaphthalene-4,4'-6H-1,3-oxazine]-2'-amine |
|---|---|
| PubChem CID | 123331801 |
| Molecular Formula | C19H14F4N4O |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | (4R)-1,1,5',5'-tetrafluoro-6-(5-isocyano-3-pyridinyl)spiro[2,3-dihydronaphthalene-4,4'-6H-1,3-oxazine]-2'-amine |
| SMILES | [C-]#[N+]c1cncc(-c2ccc3c(c2)[C@@]2(CCC3(F)F)N=C(N)OCC2(F)F)c1 |
| InChI | InChI=1S/C19H14F4N4O/c1-25-13-6-12(8-26-9-13)11-2-3-14-15(7-11)17(4-5-18(14,20)21)19(22,23)10-28-16(24)27-17/h2-3,6-9H,4-5,10H2,(H2,24,27)/t17-/m1/s1 |
| InChIKey | UWROUXZZLNMEIM-QGZVFWFLSA-N |
| XLogP | 4.36 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|