C24H34N4 — CID 123333403
2,18-diethyl-1,2,4,16,18-pentamethyl-4,7,13,16-tetrazapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-5,8(19),9,11,14-pentaene (PubChem CID 123333403) has the molecular formula C24H34N4 and a molecular weight of 378.56 g/mol. Its IUPAC name is 2,18-diethyl-1,2,4,16,18-pentamethyl-4,7,13,16-tetrazapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-5,8(19),9,11,14-pentaene.
| Compound Name | 2,18-diethyl-1,2,4,16,18-pentamethyl-4,7,13,16-tetrazapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-5,8(19),9,11,14-pentaene |
|---|---|
| PubChem CID | 123333403 |
| Molecular Formula | C24H34N4 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | 2,18-diethyl-1,2,4,16,18-pentamethyl-4,7,13,16-tetrazapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-5,8(19),9,11,14-pentaene |
| SMILES | CCC1(C)C2N(C)C=CN2c2cccc3c2C1(C)C(C)(CC)C1N(C)C=CN31 |
| InChI | InChI=1S/C24H34N4/c1-8-22(3)20-25(6)13-15-27(20)17-11-10-12-18-19(17)24(22,5)23(4,9-2)21-26(7)14-16-28(18)21/h10-16,20-21H,8-9H2,1-7H3 |
| InChIKey | QNDHEZULJMAZTG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |