C19H22N4 — CID 130458154
2,4,16,18-tetramethyl-4,7,13,16-tetrazahexacyclo[10.6.1.02,18.03,7.08,19.013,17]nonadeca-5,8(19),9,11,14-pentaene (PubChem CID 130458154) has the molecular formula C19H22N4 and a molecular weight of 306.41 g/mol. Its IUPAC name is 2,4,16,18-tetramethyl-4,7,13,16-tetrazahexacyclo[10.6.1.02,18.03,7.08,19.013,17]nonadeca-5,8(19),9,11,14-pentaene.
| Compound Name | 2,4,16,18-tetramethyl-4,7,13,16-tetrazahexacyclo[10.6.1.02,18.03,7.08,19.013,17]nonadeca-5,8(19),9,11,14-pentaene |
|---|---|
| PubChem CID | 130458154 |
| Molecular Formula | C19H22N4 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 2,4,16,18-tetramethyl-4,7,13,16-tetrazahexacyclo[10.6.1.02,18.03,7.08,19.013,17]nonadeca-5,8(19),9,11,14-pentaene |
| SMILES | CN1C=CN2c3cccc4c3C3C(C)(C12)C3(C)C1N(C)C=CN41 |
| InChI | InChI=1S/C19H22N4/c1-18-15-14-12(22-10-8-20(3)16(18)22)6-5-7-13(14)23-11-9-21(4)17(23)19(15,18)2/h5-11,15-17H,1-4H3 |
| InChIKey | DWQRFZFXLZWHIY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |