C18H22N4 — CID 129254186
1,3,15,17-tetramethyl-3,6,12,15-tetrazapentacyclo[9.6.1.02,6.07,18.012,16]octadeca-4,7,9,11(18),13-pentaene (PubChem CID 129254186) has the molecular formula C18H22N4 and a molecular weight of 294.40 g/mol. Its IUPAC name is 1,3,15,17-tetramethyl-3,6,12,15-tetrazapentacyclo[9.6.1.02,6.07,18.012,16]octadeca-4,7,9,11(18),13-pentaene.
| Compound Name | 1,3,15,17-tetramethyl-3,6,12,15-tetrazapentacyclo[9.6.1.02,6.07,18.012,16]octadeca-4,7,9,11(18),13-pentaene |
|---|---|
| PubChem CID | 129254186 |
| Molecular Formula | C18H22N4 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 1,3,15,17-tetramethyl-3,6,12,15-tetrazapentacyclo[9.6.1.02,6.07,18.012,16]octadeca-4,7,9,11(18),13-pentaene |
| SMILES | CC1C2N(C)C=CN2c2cccc3c2C1(C)C1N(C)C=CN31 |
| InChI | InChI=1S/C18H22N4/c1-12-16-19(3)8-10-21(16)13-6-5-7-14-15(13)18(12,2)17-20(4)9-11-22(14)17/h5-12,16-17H,1-4H3 |
| InChIKey | NBPZWGJWWWSZOR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |