C23H32N2 — CID 144805601
13-butyl-2,5-diethyl-4,7-dimethyl-7,10-diazatetracyclo[9.4.0.02,5.06,10]pentadeca-1(11),3,8,12,14-pentaene (PubChem CID 144805601) has the molecular formula C23H32N2 and a molecular weight of 336.52 g/mol. Its IUPAC name is 13-butyl-2,5-diethyl-4,7-dimethyl-7,10-diazatetracyclo[9.4.0.02,5.06,10]pentadeca-1(11),3,8,12,14-pentaene.
| Compound Name | 13-butyl-2,5-diethyl-4,7-dimethyl-7,10-diazatetracyclo[9.4.0.02,5.06,10]pentadeca-1(11),3,8,12,14-pentaene |
|---|---|
| PubChem CID | 144805601 |
| Molecular Formula | C23H32N2 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.26 |
| IUPAC Name | 13-butyl-2,5-diethyl-4,7-dimethyl-7,10-diazatetracyclo[9.4.0.02,5.06,10]pentadeca-1(11),3,8,12,14-pentaene |
| SMILES | CCCCc1ccc2c(c1)N1C=CN(C)C1C1(CC)C(C)=CC21CC |
| InChI | InChI=1S/C23H32N2/c1-6-9-10-18-11-12-19-20(15-18)25-14-13-24(5)21(25)23(8-3)17(4)16-22(19,23)7-2/h11-16,21H,6-10H2,1-5H3 |
| InChIKey | SYDPMCAEMDQICB-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|