C13H11BN2O5 — CID 123335106
[4-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methoxy]phenyl]boronic acid (PubChem CID 123335106) has the molecular formula C13H11BN2O5 and a molecular weight of 286.05 g/mol. Its IUPAC name is [4-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methoxy]phenyl]boronic acid.
| Compound Name | [4-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methoxy]phenyl]boronic acid |
|---|---|
| PubChem CID | 123335106 |
| Molecular Formula | C13H11BN2O5 |
| Molecular Weight | 286.05 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | [4-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]methoxy]phenyl]boronic acid |
| SMILES | OB(O)c1ccc(OCc2nnc(-c3ccco3)o2)cc1 |
| InChI | InChI=1S/C13H11BN2O5/c17-14(18)9-3-5-10(6-4-9)20-8-12-15-16-13(21-12)11-2-1-7-19-11/h1-7,17-18H,8H2 |
| InChIKey | PDZVOPWUYZUKAP-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 101.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.05 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|