C7H17Si- — CID 123335817
2,3-dimethylpentylsilane (PubChem CID 123335817) has the molecular formula C7H17Si- and a molecular weight of 129.30 g/mol. Its IUPAC name is 2,3-dimethylpentylsilane.
| Compound Name | 2,3-dimethylpentylsilane |
|---|---|
| PubChem CID | 123335817 |
| Molecular Formula | C7H17Si- |
| Molecular Weight | 129.30 g/mol |
| Exact Mass | 129.11 |
| IUPAC Name | 2,3-dimethylpentylsilane |
| SMILES | C[CH-]C(C)C(C)C[SiH3] |
| InChI | InChI=1S/C7H17Si/c1-4-6(2)7(3)5-8/h4,6-7H,5H2,1-3,8H3/q-1 |
| InChIKey | YLBFROWHXBCSMT-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|