C9H19Y3 — CID 177285354
carbanide;(3R,4S)-3,4-dimethylhexane;bis(yttrium);yttrium(3+) (PubChem CID 177285354) has the molecular formula C9H19Y3 and a molecular weight of 393.97 g/mol. Its IUPAC name is carbanide;(3R,4S)-3,4-dimethylhexane;bis(yttrium);yttrium(3+).
| Compound Name | carbanide;(3R,4S)-3,4-dimethylhexane;bis(yttrium);yttrium(3+) |
|---|---|
| PubChem CID | 177285354 |
| Molecular Formula | C9H19Y3 |
| Molecular Weight | 393.97 g/mol |
| Exact Mass | 393.87 |
| IUPAC Name | carbanide;(3R,4S)-3,4-dimethylhexane;bis(yttrium);yttrium(3+) |
| SMILES | C[CH-][C@@H](C)[C@@H](C)[CH-]C.[CH3-].[Y+3].[Y].[Y] |
| InChI | InChI=1S/C8H16.CH3.3Y/c1-5-7(3)8(4)6-2;;;;/h5-8H,1-4H3;1H3;;;/q-2;-1;;;+3/t7-,8+;;;; |
| InChIKey | HEPUMVMYACFXKF-XFOIBMPCSA-N |
| XLogP | 3.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.97 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|