About 2-methylbutane;zinc
2-methylbutane;zinc (PubChem CID 174944394) has the molecular formula C5H11Zn-
and a molecular weight of 136.53 g/mol. Its IUPAC name is 2-methylbutane;zinc.
Molecular Properties
| Compound Name | 2-methylbutane;zinc |
| PubChem CID | 174944394 |
| Molecular Formula | C5H11Zn- |
| Molecular Weight | 136.53 g/mol |
| Exact Mass | 135.02 |
| IUPAC Name | 2-methylbutane;zinc |
| SMILES | C[CH-]C(C)C.[Zn] |
| InChI | InChI=1S/C5H11.Zn/c1-4-5(2)3;/h4-5H,1-3H3;/q-1; |
| InChIKey | UYFCFQJVYAVVHZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.53 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbutane;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutane;zinc?
The IUPAC name of 2-methylbutane;zinc (CID 174944394) is 2-methylbutane;zinc.
What is the SMILES notation for 2-methylbutane;zinc?
The canonical SMILES for 2-methylbutane;zinc is C[CH-]C(C)C.[Zn].
What is the InChIKey of 2-methylbutane;zinc?
The InChIKey is UYFCFQJVYAVVHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11.Zn/c1-4-5(2)3;/h4-5H,1-3H3;/q-1;.
What are the key properties of 2-methylbutane;zinc?
2-methylbutane;zinc has a molecular weight of 136.53 g/mol, XLogP of 1.86, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutane;zinc is sourced from PubChem (CID 174944394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).