About ethane;3-methylpentane;tungsten(2+)
ethane;3-methylpentane;tungsten(2+) (PubChem CID 161154116) has the molecular formula C8H18W
and a molecular weight of 298.07 g/mol. Its IUPAC name is ethane;3-methylpentane;tungsten(2+).
Molecular Properties
| Compound Name | ethane;3-methylpentane;tungsten(2+) |
| PubChem CID | 161154116 |
| Molecular Formula | C8H18W |
| Molecular Weight | 298.07 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | ethane;3-methylpentane;tungsten(2+) |
| SMILES | C[CH-]C(C)CC.[CH2-]C.[W+2] |
| InChI | InChI=1S/C6H13.C2H5.W/c1-4-6(3)5-2;1-2;/h4,6H,5H2,1-3H3;1H2,2H3;/q2*-1;+2 |
| InChIKey | UPBMCDPHIWCYBZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.07 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-methylpentane;tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methylpentane;tungsten(2+)?
The IUPAC name of ethane;3-methylpentane;tungsten(2+) (CID 161154116) is ethane;3-methylpentane;tungsten(2+).
What is the SMILES notation for ethane;3-methylpentane;tungsten(2+)?
The canonical SMILES for ethane;3-methylpentane;tungsten(2+) is C[CH-]C(C)CC.[CH2-]C.[W+2].
What is the InChIKey of ethane;3-methylpentane;tungsten(2+)?
The InChIKey is UPBMCDPHIWCYBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13.C2H5.W/c1-4-6(3)5-2;1-2;/h4,6H,5H2,1-3H3;1H2,2H3;/q2*-1;+2.
What are the key properties of ethane;3-methylpentane;tungsten(2+)?
ethane;3-methylpentane;tungsten(2+) has a molecular weight of 298.07 g/mol, XLogP of 3.09, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methylpentane;tungsten(2+) is sourced from PubChem (CID 161154116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).