About [(2S)-butan-2-yl]arsane
[(2S)-butan-2-yl]arsane (PubChem CID 173469724) has the molecular formula C4H11As
and a molecular weight of 134.05 g/mol. Its IUPAC name is [(2S)-butan-2-yl]arsane.
Molecular Properties
| Compound Name | [(2S)-butan-2-yl]arsane |
| PubChem CID | 173469724 |
| Molecular Formula | C4H11As |
| Molecular Weight | 134.05 g/mol |
| Exact Mass | 134.01 |
| IUPAC Name | [(2S)-butan-2-yl]arsane |
| SMILES | CC[C@H](C)[AsH2] |
| InChI | InChI=1S/C4H11As/c1-3-4(2)5/h4H,3,5H2,1-2H3/t4-/m0/s1 |
| InChIKey | DYFNMWAAEMCIBX-BYPYZUCNSA-N |
| XLogP | 0.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.05 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-butan-2-yl]arsane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-butan-2-yl]arsane?
The IUPAC name of [(2S)-butan-2-yl]arsane (CID 173469724) is [(2S)-butan-2-yl]arsane.
What is the SMILES notation for [(2S)-butan-2-yl]arsane?
The canonical SMILES for [(2S)-butan-2-yl]arsane is CC[C@H](C)[AsH2].
What is the InChIKey of [(2S)-butan-2-yl]arsane?
The InChIKey is DYFNMWAAEMCIBX-BYPYZUCNSA-N. The full InChI is InChI=1S/C4H11As/c1-3-4(2)5/h4H,3,5H2,1-2H3/t4-/m0/s1.
What are the key properties of [(2S)-butan-2-yl]arsane?
[(2S)-butan-2-yl]arsane has a molecular weight of 134.05 g/mol, XLogP of 0.84, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-butan-2-yl]arsane is sourced from PubChem (CID 173469724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).