About 2,5-dimethylheptane
2,5-dimethylheptane (PubChem CID 90751376) has the molecular formula C9H19-
and a molecular weight of 127.25 g/mol. Its IUPAC name is 2,5-dimethylheptane.
Molecular Properties
| Compound Name | 2,5-dimethylheptane |
| PubChem CID | 90751376 |
| Molecular Formula | C9H19- |
| Molecular Weight | 127.25 g/mol |
| Exact Mass | 127.15 |
| IUPAC Name | 2,5-dimethylheptane |
| SMILES | CCC(C)[CH-]CC(C)C |
| InChI | InChI=1S/C9H19/c1-5-9(4)7-6-8(2)3/h7-9H,5-6H2,1-4H3/q-1 |
| InChIKey | CEEGUQILYPWHIQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.25 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethylheptane?
The IUPAC name of 2,5-dimethylheptane (CID 90751376) is 2,5-dimethylheptane.
What is the SMILES notation for 2,5-dimethylheptane?
The canonical SMILES for 2,5-dimethylheptane is CCC(C)[CH-]CC(C)C.
What is the InChIKey of 2,5-dimethylheptane?
The InChIKey is CEEGUQILYPWHIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19/c1-5-9(4)7-6-8(2)3/h7-9H,5-6H2,1-4H3/q-1.
What are the key properties of 2,5-dimethylheptane?
2,5-dimethylheptane has a molecular weight of 127.25 g/mol, XLogP of 3.28, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethylheptane is sourced from PubChem (CID 90751376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).