About 3-methylhexane;neptunium;2-nitrosopropane
3-methylhexane;neptunium;2-nitrosopropane (PubChem CID 163446837) has the molecular formula C10H21NNpO-2
and a molecular weight of 408.28 g/mol. Its IUPAC name is 3-methylhexane;neptunium;2-nitrosopropane.
Molecular Properties
| Compound Name | 3-methylhexane;neptunium;2-nitrosopropane |
| PubChem CID | 163446837 |
| Molecular Formula | C10H21NNpO-2 |
| Molecular Weight | 408.28 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 3-methylhexane;neptunium;2-nitrosopropane |
| SMILES | CC[CH-]C(C)CC.[CH2-]C(C)N=O.[Np] |
| InChI | InChI=1S/C7H15.C3H6NO.Np/c1-4-6-7(3)5-2;1-3(2)4-5;/h6-7H,4-5H2,1-3H3;3H,1H2,2H3;/q2*-1; |
| InChIKey | OVFDIUSWAUZOID-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.28 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-methylhexane;neptunium;2-nitrosopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylhexane;neptunium;2-nitrosopropane?
The IUPAC name of 3-methylhexane;neptunium;2-nitrosopropane (CID 163446837) is 3-methylhexane;neptunium;2-nitrosopropane.
What is the SMILES notation for 3-methylhexane;neptunium;2-nitrosopropane?
The canonical SMILES for 3-methylhexane;neptunium;2-nitrosopropane is CC[CH-]C(C)CC.[CH2-]C(C)N=O.[Np].
What is the InChIKey of 3-methylhexane;neptunium;2-nitrosopropane?
The InChIKey is OVFDIUSWAUZOID-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15.C3H6NO.Np/c1-4-6-7(3)5-2;1-3(2)4-5;/h6-7H,4-5H2,1-3H3;3H,1H2,2H3;/q2*-1;.
What are the key properties of 3-methylhexane;neptunium;2-nitrosopropane?
3-methylhexane;neptunium;2-nitrosopropane has a molecular weight of 408.28 g/mol, XLogP of 3.62, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylhexane;neptunium;2-nitrosopropane is sourced from PubChem (CID 163446837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).