About 1-methoxy-2-methylbutane
1-methoxy-2-methylbutane (PubChem CID 123433136) has the molecular formula C6H13O-
and a molecular weight of 101.17 g/mol. Its IUPAC name is 1-methoxy-2-methylbutane.
Molecular Properties
| Compound Name | 1-methoxy-2-methylbutane |
| PubChem CID | 123433136 |
| Molecular Formula | C6H13O- |
| Molecular Weight | 101.17 g/mol |
| Exact Mass | 101.10 |
| IUPAC Name | 1-methoxy-2-methylbutane |
| SMILES | CCC(C)[CH-]OC |
| InChI | InChI=1S/C6H13O/c1-4-6(2)5-7-3/h5-6H,4H2,1-3H3/q-1 |
| InChIKey | GBAOYBYHFSKUME-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.17 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-2-methylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-2-methylbutane?
The IUPAC name of 1-methoxy-2-methylbutane (CID 123433136) is 1-methoxy-2-methylbutane.
What is the SMILES notation for 1-methoxy-2-methylbutane?
The canonical SMILES for 1-methoxy-2-methylbutane is CCC(C)[CH-]OC.
What is the InChIKey of 1-methoxy-2-methylbutane?
The InChIKey is GBAOYBYHFSKUME-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13O/c1-4-6(2)5-7-3/h5-6H,4H2,1-3H3/q-1.
What are the key properties of 1-methoxy-2-methylbutane?
1-methoxy-2-methylbutane has a molecular weight of 101.17 g/mol, XLogP of 1.84, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-2-methylbutane is sourced from PubChem (CID 123433136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).