About 6-methylhept-3-yne;tris(yttrium)
6-methylhept-3-yne;tris(yttrium) (PubChem CID 59973578) has the molecular formula C8H13Y3-
and a molecular weight of 375.91 g/mol. Its IUPAC name is 6-methylhept-3-yne;tris(yttrium).
Molecular Properties
| Compound Name | 6-methylhept-3-yne;tris(yttrium) |
| PubChem CID | 59973578 |
| Molecular Formula | C8H13Y3- |
| Molecular Weight | 375.91 g/mol |
| Exact Mass | 375.82 |
| IUPAC Name | 6-methylhept-3-yne;tris(yttrium) |
| SMILES | C[CH-]C#CCC(C)C.[Y].[Y].[Y] |
| InChI | InChI=1S/C8H13.3Y/c1-4-5-6-7-8(2)3;;;/h4,8H,7H2,1-3H3;;;/q-1;;; |
| InChIKey | BVKLYFVNWBETSR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.91 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-methylhept-3-yne;tris(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylhept-3-yne;tris(yttrium)?
The IUPAC name of 6-methylhept-3-yne;tris(yttrium) (CID 59973578) is 6-methylhept-3-yne;tris(yttrium).
What is the SMILES notation for 6-methylhept-3-yne;tris(yttrium)?
The canonical SMILES for 6-methylhept-3-yne;tris(yttrium) is C[CH-]C#CCC(C)C.[Y].[Y].[Y].
What is the InChIKey of 6-methylhept-3-yne;tris(yttrium)?
The InChIKey is BVKLYFVNWBETSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13.3Y/c1-4-5-6-7-8(2)3;;;/h4,8H,7H2,1-3H3;;;/q-1;;;.
What are the key properties of 6-methylhept-3-yne;tris(yttrium)?
6-methylhept-3-yne;tris(yttrium) has a molecular weight of 375.91 g/mol, XLogP of 2.25, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylhept-3-yne;tris(yttrium) is sourced from PubChem (CID 59973578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).