C10H14O2 — CID 129384337
(2R,9R)-deca-4,6-diyne-2,9-diol (PubChem CID 129384337) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (2R,9R)-deca-4,6-diyne-2,9-diol.
| Compound Name | (2R,9R)-deca-4,6-diyne-2,9-diol |
|---|---|
| PubChem CID | 129384337 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (2R,9R)-deca-4,6-diyne-2,9-diol |
| SMILES | C[C@@H](O)CC#CC#CC[C@@H](C)O |
| InChI | InChI=1S/C10H14O2/c1-9(11)7-5-3-4-6-8-10(2)12/h9-12H,7-8H2,1-2H3/t9-,10-/m1/s1 |
| InChIKey | UYXWWHBGXDHVNP-NXEZZACHSA-N |
| XLogP | 0.54 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|