C10H21- — CID 90745776
2,4,5-trimethylheptane (PubChem CID 90745776) has the molecular formula C10H21- and a molecular weight of 141.28 g/mol. Its IUPAC name is 2,4,5-trimethylheptane.
| Compound Name | 2,4,5-trimethylheptane |
|---|---|
| PubChem CID | 90745776 |
| Molecular Formula | C10H21- |
| Molecular Weight | 141.28 g/mol |
| Exact Mass | 141.16 |
| IUPAC Name | 2,4,5-trimethylheptane |
| SMILES | CCC(C)C(C)[CH-]C(C)C |
| InChI | InChI=1S/C10H21/c1-6-9(4)10(5)7-8(2)3/h7-10H,6H2,1-5H3/q-1 |
| InChIKey | RQZHLYNQNDRZQB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|