C45H47N — CID 123336442
2-(9,9-dimethylfluoren-2-yl)-9-(9,9-dimethyl-1,2,5,6-tetrahydrofluoren-2-yl)-10-methyl-6,6a,7,10,11,11a-hexahydro-5H-cyclohepta[h]quinoline (PubChem CID 123336442) has the molecular formula C45H47N and a molecular weight of 601.88 g/mol. Its IUPAC name is 2-(9,9-dimethylfluoren-2-yl)-9-(9,9-dimethyl-1,2,5,6-tetrahydrofluoren-2-yl)-10-methyl-6,6a,7,10,11,11a-hexahydro-5H-cyclohepta[h]quinoline.
| Compound Name | 2-(9,9-dimethylfluoren-2-yl)-9-(9,9-dimethyl-1,2,5,6-tetrahydrofluoren-2-yl)-10-methyl-6,6a,7,10,11,11a-hexahydro-5H-cyclohepta[h]quinoline |
|---|---|
| PubChem CID | 123336442 |
| Molecular Formula | C45H47N |
| Molecular Weight | 601.88 g/mol |
| Exact Mass | 601.37 |
| IUPAC Name | 2-(9,9-dimethylfluoren-2-yl)-9-(9,9-dimethyl-1,2,5,6-tetrahydrofluoren-2-yl)-10-methyl-6,6a,7,10,11,11a-hexahydro-5H-cyclohepta[h]quinoline |
| SMILES | CC1CC2c3nc(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)ccc3CCC2CC=C1C1C=CC2=C(C1)C(C)(C)C1=C2CCC=C1 |
| InChI | InChI=1S/C45H47N/c1-27-24-37-28(16-20-32(27)30-17-21-35-33-10-6-8-12-38(33)44(2,3)40(35)25-30)14-15-29-19-23-42(46-43(29)37)31-18-22-36-34-11-7-9-13-39(34)45(4,5)41(36)26-31/h7-9,11-13,17-23,26-28,30,37H,6,10,14-16,24-25H2,1-5H3 |
| InChIKey | PVTOOZSMUCXNQR-UHFFFAOYSA-N |
| XLogP | 11.62 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.88 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|