C42H38N2 — CID 70806657
2-(9,9-dimethyl-5,6-dihydrofluoren-2-yl)-9-(9,9-dimethyl-1,2,5,6-tetrahydrofluoren-2-yl)-1,10-phenanthroline (PubChem CID 70806657) has the molecular formula C42H38N2 and a molecular weight of 570.78 g/mol. Its IUPAC name is 2-(9,9-dimethyl-5,6-dihydrofluoren-2-yl)-9-(9,9-dimethyl-1,2,5,6-tetrahydrofluoren-2-yl)-1,10-phenanthroline.
| Compound Name | 2-(9,9-dimethyl-5,6-dihydrofluoren-2-yl)-9-(9,9-dimethyl-1,2,5,6-tetrahydrofluoren-2-yl)-1,10-phenanthroline |
|---|---|
| PubChem CID | 70806657 |
| Molecular Formula | C42H38N2 |
| Molecular Weight | 570.78 g/mol |
| Exact Mass | 570.30 |
| IUPAC Name | 2-(9,9-dimethyl-5,6-dihydrofluoren-2-yl)-9-(9,9-dimethyl-1,2,5,6-tetrahydrofluoren-2-yl)-1,10-phenanthroline |
| SMILES | CC1(C)C2=C(CCC=C2)C2=C1CC(c1ccc3ccc4ccc(-c5ccc6c(c5)C(C)(C)C5=C6CCC=C5)nc4c3n1)C=C2 |
| InChI | InChI=1S/C42H38N2/c1-41(2)33-11-7-5-9-29(33)31-19-15-27(23-35(31)41)37-21-17-25-13-14-26-18-22-38(44-40(26)39(25)43-37)28-16-20-32-30-10-6-8-12-34(30)42(3,4)36(32)24-28/h7-8,11-23,28H,5-6,9-10,24H2,1-4H3 |
| InChIKey | GJSWAAMMQHFIIA-UHFFFAOYSA-N |
| XLogP | 10.87 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.78 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|