C13H25N — CID 123337653
2-(4-ethyl-2,3,5-trimethylcyclohex-3-en-1-yl)ethanamine (PubChem CID 123337653) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is 2-(4-ethyl-2,3,5-trimethylcyclohex-3-en-1-yl)ethanamine.
| Compound Name | 2-(4-ethyl-2,3,5-trimethylcyclohex-3-en-1-yl)ethanamine |
|---|---|
| PubChem CID | 123337653 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 2-(4-ethyl-2,3,5-trimethylcyclohex-3-en-1-yl)ethanamine |
| SMILES | CCC1=C(C)C(C)C(CCN)CC1C |
| InChI | InChI=1S/C13H25N/c1-5-13-9(2)8-12(6-7-14)10(3)11(13)4/h9-10,12H,5-8,14H2,1-4H3 |
| InChIKey | IWWIJKQSPNVHTE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|