C19H18BrN5O — CID 123340752
7-bromo-6-(5-butoxy-3-pyridinyl)-4-methyl-[1,2,4]triazolo[4,3-a]quinoxaline (PubChem CID 123340752) has the molecular formula C19H18BrN5O and a molecular weight of 412.29 g/mol. Its IUPAC name is 7-bromo-6-(5-butoxy-3-pyridinyl)-4-methyl-[1,2,4]triazolo[4,3-a]quinoxaline.
| Compound Name | 7-bromo-6-(5-butoxy-3-pyridinyl)-4-methyl-[1,2,4]triazolo[4,3-a]quinoxaline |
|---|---|
| PubChem CID | 123340752 |
| Molecular Formula | C19H18BrN5O |
| Molecular Weight | 412.29 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 7-bromo-6-(5-butoxy-3-pyridinyl)-4-methyl-[1,2,4]triazolo[4,3-a]quinoxaline |
| SMILES | CCCCOc1cncc(-c2c(Br)ccc3c2nc(C)c2nncn23)c1 |
| InChI | InChI=1S/C19H18BrN5O/c1-3-4-7-26-14-8-13(9-21-10-14)17-15(20)5-6-16-18(17)23-12(2)19-24-22-11-25(16)19/h5-6,8-11H,3-4,7H2,1-2H3 |
| InChIKey | XISRXWNWSMGGNL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 65.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.29 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|