C38H37NO4 — CID 123342098
[4-(5,7-dimethylnona-2,4-dien-2-yl)phenyl] 4-[[4-(4-cyanophenyl)phenoxy]methoxy]benzoate (PubChem CID 123342098) has the molecular formula C38H37NO4 and a molecular weight of 571.72 g/mol. Its IUPAC name is [4-(5,7-dimethylnona-2,4-dien-2-yl)phenyl] 4-[[4-(4-cyanophenyl)phenoxy]methoxy]benzoate.
| Compound Name | [4-(5,7-dimethylnona-2,4-dien-2-yl)phenyl] 4-[[4-(4-cyanophenyl)phenoxy]methoxy]benzoate |
|---|---|
| PubChem CID | 123342098 |
| Molecular Formula | C38H37NO4 |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.27 |
| IUPAC Name | [4-(5,7-dimethylnona-2,4-dien-2-yl)phenyl] 4-[[4-(4-cyanophenyl)phenoxy]methoxy]benzoate |
| SMILES | CCC(C)CC(C)=CC=C(C)c1ccc(OC(=O)c2ccc(OCOc3ccc(-c4ccc(C#N)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H37NO4/c1-5-27(2)24-28(3)6-7-29(4)31-12-22-37(23-13-31)43-38(40)34-16-20-36(21-17-34)42-26-41-35-18-14-33(15-19-35)32-10-8-30(25-39)9-11-32/h6-23,27H,5,24,26H2,1-4H3 |
| InChIKey | AJIHIHFINGHSHK-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|