C25H42O6 — CID 123343380
[3,5-bis(methoxymethoxy)-1-tetracyclo[5.2.1.03,8.05,8]decanyl] 2,4,4-trimethyl-2-propan-2-ylpentanoate (PubChem CID 123343380) has the molecular formula C25H42O6 and a molecular weight of 438.61 g/mol. Its IUPAC name is [3,5-bis(methoxymethoxy)-1-tetracyclo[5.2.1.03,8.05,8]decanyl] 2,4,4-trimethyl-2-propan-2-ylpentanoate.
| Compound Name | [3,5-bis(methoxymethoxy)-1-tetracyclo[5.2.1.03,8.05,8]decanyl] 2,4,4-trimethyl-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 123343380 |
| Molecular Formula | C25H42O6 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | [3,5-bis(methoxymethoxy)-1-tetracyclo[5.2.1.03,8.05,8]decanyl] 2,4,4-trimethyl-2-propan-2-ylpentanoate |
| SMILES | COCOC12CC3CC4(OC(=O)C(C)(CC(C)(C)C)C(C)C)CC(OCOC)(C1)C32C4 |
| InChI | InChI=1S/C25H42O6/c1-17(2)21(6,11-20(3,4)5)19(26)31-22-9-18-10-23(29-15-27-7)14-24(12-22,30-16-28-8)25(18,23)13-22/h17-18H,9-16H2,1-8H3 |
| InChIKey | QIJRWIDPCPQERI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|