2-silylacetyl chloride

C2H5ClOSi — CID 123343525

IUPAC2-silylacetyl chloride
SMILESO=C(Cl)C[SiH3]
InChIInChI=1S/C2H5ClOSi/c3-2(4)1-5/h1H2,5H3
InChIKeyKKONVHYCCHSZDI-UHFFFAOYSA-N
MW108.60 g/mol
LogP-0.46
Rot. Bonds1

About 2-silylacetyl chloride

2-silylacetyl chloride (PubChem CID 123343525) has the molecular formula C2H5ClOSi and a molecular weight of 108.60 g/mol. Its IUPAC name is 2-silylacetyl chloride.

Molecular Properties

Compound Name2-silylacetyl chloride
PubChem CID123343525
Molecular FormulaC2H5ClOSi
Molecular Weight108.60 g/mol
Exact Mass107.98
IUPAC Name2-silylacetyl chloride
SMILESO=C(Cl)C[SiH3]
InChIInChI=1S/C2H5ClOSi/c3-2(4)1-5/h1H2,5H3
InChIKeyKKONVHYCCHSZDI-UHFFFAOYSA-N
XLogP-0.46
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms5
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500108.60
LogP ≤ 5-0.46
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze 2-silylacetyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-chloroacetyl chloride;silane
CID 174549758
CID 54492639
CID 54492639
2-iodoacetyl chloride
CID 3084680
2-(18F)fluoroacetyl chloride
CID 24764366
3-oxopentanedioyl dichloride
CID 134894189
2-aminoacetyl chloride;hydrochloride
CID 15561435
2-chloroacetyl chloride;ethane
CID 144520290
2-phosphorosoacetyl chloride
CID 90337837
tricarbonochloridoylsilylformyl chloride
CID 174860446
CID 175730085
CID 175730085
propanoyl chloride;urea
CID 174974689
3-aminopropanoyl chloride
CID 11217318

Frequently Asked Questions

What is the IUPAC name of 2-silylacetyl chloride?
The IUPAC name of 2-silylacetyl chloride (CID 123343525) is 2-silylacetyl chloride.
What is the SMILES notation for 2-silylacetyl chloride?
The canonical SMILES for 2-silylacetyl chloride is O=C(Cl)C[SiH3].
What is the InChIKey of 2-silylacetyl chloride?
The InChIKey is KKONVHYCCHSZDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5ClOSi/c3-2(4)1-5/h1H2,5H3.
What are the key properties of 2-silylacetyl chloride?
2-silylacetyl chloride has a molecular weight of 108.60 g/mol, XLogP of -0.46, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-silylacetyl chloride is sourced from PubChem (CID 123343525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).