C20H27N3O4S — CID 123344533
N'-[(Z)-1-(3,5-dimethoxyphenyl)-3-(dimethylamino)prop-1-enyl]-4-methylbenzenesulfonohydrazide (PubChem CID 123344533) has the molecular formula C20H27N3O4S and a molecular weight of 405.52 g/mol. Its IUPAC name is N'-[(Z)-1-(3,5-dimethoxyphenyl)-3-(dimethylamino)prop-1-enyl]-4-methylbenzenesulfonohydrazide.
| Compound Name | N'-[(Z)-1-(3,5-dimethoxyphenyl)-3-(dimethylamino)prop-1-enyl]-4-methylbenzenesulfonohydrazide |
|---|---|
| PubChem CID | 123344533 |
| Molecular Formula | C20H27N3O4S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | N'-[(Z)-1-(3,5-dimethoxyphenyl)-3-(dimethylamino)prop-1-enyl]-4-methylbenzenesulfonohydrazide |
| SMILES | COc1cc(OC)cc(/C(=C/CN(C)C)NNS(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C20H27N3O4S/c1-15-6-8-19(9-7-15)28(24,25)22-21-20(10-11-23(2)3)16-12-17(26-4)14-18(13-16)27-5/h6-10,12-14,21-22H,11H2,1-5H3/b20-10- |
| InChIKey | KGNMEESEWCSEFO-JMIUGGIZSA-N |
| XLogP | 2.40 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|