C14H19N — CID 123345087
3-[cyclohex-2-en-1-yl(isocyano)methyl]cyclohexene (PubChem CID 123345087) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 3-[cyclohex-2-en-1-yl(isocyano)methyl]cyclohexene.
| Compound Name | 3-[cyclohex-2-en-1-yl(isocyano)methyl]cyclohexene |
|---|---|
| PubChem CID | 123345087 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 3-[cyclohex-2-en-1-yl(isocyano)methyl]cyclohexene |
| SMILES | [C-]#[N+]C(C1C=CCCC1)C1C=CCCC1 |
| InChI | InChI=1S/C14H19N/c1-15-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h4,6,8,10,12-14H,2-3,5,7,9,11H2 |
| InChIKey | LCQOLKBBYINKNX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|