C8H13N — CID 123345660
N,4-dimethylcyclohex-2-en-1-imine (PubChem CID 123345660) has the molecular formula C8H13N and a molecular weight of 123.20 g/mol. Its IUPAC name is N,4-dimethylcyclohex-2-en-1-imine.
| Compound Name | N,4-dimethylcyclohex-2-en-1-imine |
|---|---|
| PubChem CID | 123345660 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | N,4-dimethylcyclohex-2-en-1-imine |
| SMILES | C/N=C1/C=CC(C)CC1 |
| InChI | InChI=1S/C8H13N/c1-7-3-5-8(9-2)6-4-7/h3,5,7H,4,6H2,1-2H3/b9-8- |
| InChIKey | ADBAFSXTMMHFBG-HJWRWDBZSA-N |
| XLogP | 2.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|