C10H13N — CID 57323267
3-methyl-2,3,5,8-tetrahydroquinoline (PubChem CID 57323267) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is 3-methyl-2,3,5,8-tetrahydroquinoline.
| Compound Name | 3-methyl-2,3,5,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 57323267 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 3-methyl-2,3,5,8-tetrahydroquinoline |
| SMILES | CC1C=C2CC=CCC2=NC1 |
| InChI | InChI=1S/C10H13N/c1-8-6-9-4-2-3-5-10(9)11-7-8/h2-3,6,8H,4-5,7H2,1H3 |
| InChIKey | IZFPBRCOHOVVTG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|