C16H42O3S4Si4 — CID 123346721
3-[[[dimethyl(3-sulfanylpropyl)silyl]oxy-methyl-(3-sulfanylpropyl)silyl]oxy-methyl-(3-sulfanylpropyl)silyl]oxysilylpropane-1-thiol (PubChem CID 123346721) has the molecular formula C16H42O3S4Si4 and a molecular weight of 523.12 g/mol. Its IUPAC name is 3-[[[dimethyl(3-sulfanylpropyl)silyl]oxy-methyl-(3-sulfanylpropyl)silyl]oxy-methyl-(3-sulfanylpropyl)silyl]oxysilylpropane-1-thiol.
| Compound Name | 3-[[[dimethyl(3-sulfanylpropyl)silyl]oxy-methyl-(3-sulfanylpropyl)silyl]oxy-methyl-(3-sulfanylpropyl)silyl]oxysilylpropane-1-thiol |
|---|---|
| PubChem CID | 123346721 |
| Molecular Formula | C16H42O3S4Si4 |
| Molecular Weight | 523.12 g/mol |
| Exact Mass | 522.11 |
| IUPAC Name | 3-[[[dimethyl(3-sulfanylpropyl)silyl]oxy-methyl-(3-sulfanylpropyl)silyl]oxy-methyl-(3-sulfanylpropyl)silyl]oxysilylpropane-1-thiol |
| SMILES | C[Si](C)(CCCS)O[Si](C)(CCCS)O[Si](C)(CCCS)O[SiH2]CCCS |
| InChI | InChI=1S/C16H42O3S4Si4/c1-25(2,14-6-10-21)18-27(4,16-8-12-23)19-26(3,15-7-11-22)17-24-13-5-9-20/h20-23H,5-16,24H2,1-4H3 |
| InChIKey | ATPIPQFHFILMMJ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.12 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|