C11H16N4 — CID 123347129
2-methanimidoyl-5-pyrrolidin-1-ylbenzene-1,4-diamine (PubChem CID 123347129) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is 2-methanimidoyl-5-pyrrolidin-1-ylbenzene-1,4-diamine.
| Compound Name | 2-methanimidoyl-5-pyrrolidin-1-ylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 123347129 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 2-methanimidoyl-5-pyrrolidin-1-ylbenzene-1,4-diamine |
| SMILES | [H]/N=C/c1cc(N)c(N2CCCC2)cc1N |
| InChI | InChI=1S/C11H16N4/c12-7-8-5-10(14)11(6-9(8)13)15-3-1-2-4-15/h5-7,12H,1-4,13-14H2/b12-7+ |
| InChIKey | HLCFVMYFGXLPAC-KPKJPENVSA-N |
| XLogP | 1.45 |
| TPSA | 79.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|