C26H31N7 — CID 142445706
6-(4-amino-3-methanimidoylphenyl)-1-methanimidoyl-4-(4-methylpiperazin-1-yl)-7,8,9,10-tetrahydrophenanthridin-2-amine (PubChem CID 142445706) has the molecular formula C26H31N7 and a molecular weight of 441.58 g/mol. Its IUPAC name is 6-(4-amino-3-methanimidoylphenyl)-1-methanimidoyl-4-(4-methylpiperazin-1-yl)-7,8,9,10-tetrahydrophenanthridin-2-amine.
| Compound Name | 6-(4-amino-3-methanimidoylphenyl)-1-methanimidoyl-4-(4-methylpiperazin-1-yl)-7,8,9,10-tetrahydrophenanthridin-2-amine |
|---|---|
| PubChem CID | 142445706 |
| Molecular Formula | C26H31N7 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | 6-(4-amino-3-methanimidoylphenyl)-1-methanimidoyl-4-(4-methylpiperazin-1-yl)-7,8,9,10-tetrahydrophenanthridin-2-amine |
| SMILES | [H]/N=C/c1cc(-c2nc3c(N4CCN(C)CC4)cc(N)c(/C=N/[H])c3c3c2CCCC3)ccc1N |
| InChI | InChI=1S/C26H31N7/c1-32-8-10-33(11-9-32)23-13-22(30)20(15-28)24-18-4-2-3-5-19(18)25(31-26(23)24)16-6-7-21(29)17(12-16)14-27/h6-7,12-15,27-28H,2-5,8-11,29-30H2,1H3/b27-14+,28-15+ |
| InChIKey | SRBTWWKDXWEWOG-VNRWOIRSSA-N |
| XLogP | 3.69 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|