C22H26N4O2 — CID 142445826
ethane;methyl 3-(2-amino-1-methanimidoyl-7,8,9,10-tetrahydrophenanthridin-6-yl)-1H-pyrrole-2-carboxylate (PubChem CID 142445826) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is ethane;methyl 3-(2-amino-1-methanimidoyl-7,8,9,10-tetrahydrophenanthridin-6-yl)-1H-pyrrole-2-carboxylate.
| Compound Name | ethane;methyl 3-(2-amino-1-methanimidoyl-7,8,9,10-tetrahydrophenanthridin-6-yl)-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 142445826 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | ethane;methyl 3-(2-amino-1-methanimidoyl-7,8,9,10-tetrahydrophenanthridin-6-yl)-1H-pyrrole-2-carboxylate |
| SMILES | CC.[H]/N=C/c1c(N)ccc2nc(-c3cc[nH]c3C(=O)OC)c3c(c12)CCCC3 |
| InChI | InChI=1S/C20H20N4O2.C2H6/c1-26-20(25)19-13(8-9-23-19)18-12-5-3-2-4-11(12)17-14(10-21)15(22)6-7-16(17)24-18;1-2/h6-10,21,23H,2-5,22H2,1H3;1-2H3/b21-10+; |
| InChIKey | AWQZIIBLMXAPFO-FYEZMLSJSA-N |
| XLogP | 4.50 |
| TPSA | 104.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|