C21H21N5 — CID 142445238
6-(3-amino-4-methanimidoylphenyl)-1-methanimidoyl-7,8,9,10-tetrahydrophenanthridin-2-amine (PubChem CID 142445238) has the molecular formula C21H21N5 and a molecular weight of 343.43 g/mol. Its IUPAC name is 6-(3-amino-4-methanimidoylphenyl)-1-methanimidoyl-7,8,9,10-tetrahydrophenanthridin-2-amine.
| Compound Name | 6-(3-amino-4-methanimidoylphenyl)-1-methanimidoyl-7,8,9,10-tetrahydrophenanthridin-2-amine |
|---|---|
| PubChem CID | 142445238 |
| Molecular Formula | C21H21N5 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 6-(3-amino-4-methanimidoylphenyl)-1-methanimidoyl-7,8,9,10-tetrahydrophenanthridin-2-amine |
| SMILES | [H]/N=C/c1ccc(-c2nc3ccc(N)c(/C=N/[H])c3c3c2CCCC3)cc1N |
| InChI | InChI=1S/C21H21N5/c22-10-13-6-5-12(9-18(13)25)21-15-4-2-1-3-14(15)20-16(11-23)17(24)7-8-19(20)26-21/h5-11,22-23H,1-4,24-25H2/b22-10+,23-11+ |
| InChIKey | MBNRAXFLXGJRAF-CZGKVYIXSA-N |
| XLogP | 3.94 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|