C20H19N3O — CID 142445718
4-(4-amino-3-methanimidoyl-7,8,9,10-tetrahydrophenanthridin-6-yl)phenol (PubChem CID 142445718) has the molecular formula C20H19N3O and a molecular weight of 317.39 g/mol. Its IUPAC name is 4-(4-amino-3-methanimidoyl-7,8,9,10-tetrahydrophenanthridin-6-yl)phenol.
| Compound Name | 4-(4-amino-3-methanimidoyl-7,8,9,10-tetrahydrophenanthridin-6-yl)phenol |
|---|---|
| PubChem CID | 142445718 |
| Molecular Formula | C20H19N3O |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 4-(4-amino-3-methanimidoyl-7,8,9,10-tetrahydrophenanthridin-6-yl)phenol |
| SMILES | [H]/N=C/c1ccc2c3c(c(-c4ccc(O)cc4)nc2c1N)CCCC3 |
| InChI | InChI=1S/C20H19N3O/c21-11-13-7-10-17-15-3-1-2-4-16(15)19(23-20(17)18(13)22)12-5-8-14(24)9-6-12/h5-11,21,24H,1-4,22H2/b21-11+ |
| InChIKey | AQKTYYFDWSLITE-SRZZPIQSSA-N |
| XLogP | 4.07 |
| TPSA | 82.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|