C22H22N4 — CID 142445484
4-(2-amino-7,8,9,10-tetrahydrophenanthridin-6-yl)benzonitrile;ethanimine (PubChem CID 142445484) has the molecular formula C22H22N4 and a molecular weight of 342.45 g/mol. Its IUPAC name is 4-(2-amino-7,8,9,10-tetrahydrophenanthridin-6-yl)benzonitrile;ethanimine.
| Compound Name | 4-(2-amino-7,8,9,10-tetrahydrophenanthridin-6-yl)benzonitrile;ethanimine |
|---|---|
| PubChem CID | 142445484 |
| Molecular Formula | C22H22N4 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 4-(2-amino-7,8,9,10-tetrahydrophenanthridin-6-yl)benzonitrile;ethanimine |
| SMILES | N#Cc1ccc(-c2nc3ccc(N)cc3c3c2CCCC3)cc1.[H]/N=C/C |
| InChI | InChI=1S/C20H17N3.C2H5N/c21-12-13-5-7-14(8-6-13)20-17-4-2-1-3-16(17)18-11-15(22)9-10-19(18)23-20;1-2-3/h5-11H,1-4,22H2;2-3H,1H3/b;3-2+ |
| InChIKey | KYWFSZSTGZLJCZ-ZPYUXNTASA-N |
| XLogP | 4.89 |
| TPSA | 86.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|